Bromocresol Purple
CAS Number: 115-40-2
Molecular Weight: 540.22
MDL number: MFCD00011681
EC Index Number: 204-087-8
Application
- Bromocresol Purple has been used for staining of Saccharomyces cerevisiae.[1]
- Spectrophotometric determination of serum-albumin
Biochem/physiol Actions
Bromocresol purple is a pH indicator which changes color from yellow (at low pH 5.2) to violet (above pH 6.8).[2] It is mainly used as a fluorescent stain in yeast cells. It helps in dead cell count for cells with plasma membrane damage. Cells with proper cell membrane are not stained, while damaged cells are seen as blue-grey ghosts.[3]
| product line | BioReagent |
| Quality Level | 200 |
| Assay | ≥89.0% (HPLC) |
| λmax | 549 nm |
| form | powder |
| composition | Dye content, 90% |
| technique(s) | titration: suitable |
| pH | 5.2-6.8, yellow to purple |
| visual transition interval | 5.2-6.8, yellow to blue |
| mp | 240 °C (dec.) (lit.) |
| solubility | ethanol: 1 mg/mL |
| λmax | 419 nm |
| ε (extinction coefficient) | ≥22000 at 418-424 nm in methanol |
| suitability | suitable for indicator |
| application(s) | diagnostic assay manufacturing
hematology histology |
| storage temp. | room temp |
| SMILES string | Cc1cc(cc(Br)c1O)C2(OS(=O)(=O)c3ccccc23)c4cc(C)c(O)c(Br)c4 |
| InChI | 1S/C21H16Br2O5S/c1-11-7-13(9-16(22)19(11)24)21(14-8-12(2)20(25)17(23)10-14)15-5-3-4-6-18(15)29(26,27)28-21/h3-10,24-25H,1-2H3 |
| InChI key | ABIUHPWEYMSGSR-UHFFFAOYSA-N |
