2,3,5-Triphenyltetrazolium chlorid
CAS Number: 298-96-4
Molecular Weight: 334.80
MDL number: MFCD00011963
EC Index Number: 206-071-6
General description
2,3,5-Triphenyltetrazolium chloride is a colorless water-soluble dye. In the mitochondria of living cells, it is reduced to a deep red, water-insoluble compound (formazan). 2,3,5-Triphenyltetrazolium chloride helps to distinguish between viable and infarcted brain tissue after stroke.[1]
Application
2,3,5-Triphenyltetrazolium chloride has been used to stain heart tissue to measure the extent of acute lesion.[2] It has also been used to stain brain tissue to check the size of infarct area.
| Quality Level | 200 |
| Assay | ≥98.0% (HPLC) |
| form | powder |
| color | faintly yellow |
| solubility | H2O: 50 mg/mL |
| application(s) | diagnostic assay manufacturing hematology histology |
| storage temp. | 2-8°C |
| SMILES string | [Cl-].c1ccc(cc1)-c2nn(-c3ccccc3)[n+](n2)-c4ccccc4 |
| InChI | 1S/C19H15N4.ClH/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1 |
| InChI key | PKDBCJSWQUOKDO-UHFFFAOYSA-M |
